Menurut Bloor golongan lipid termasuk senyawa yg mepunyai sifat: relatif tidak larut dalam air larut dalam pelarut-pelarut organik seperti eter, Petroleum eter, Cloroform, Aseton dsb mengandung asam-asam lemak kebanyakan dalam bentuk ester dapat dipergunakan oleh organisme hidup Lipid penting karena: 1. nilai energi tinggi 2. bahan isolasi dan pelindung pada jaringan subcutan, keliling organ-organ tertentu mis: jaringan saraf 3. mengandung vitamin yang larut dalam lemak 4. mengandung asam-asam lemak esensial
Pembagian lipid menurut Bloor: 1. Simple Lipids (lipid Sederhana) 1. Lemak 2. Ester-ester asam lemak dengan Gliserol. Kalau suhu kamar cair disebut minyak, kalau padat disebut lemak. 3. Malam (waxes): Ester asam lemak dengan alkohol monohidrat berbobot molekul tinggi 2. Lipid Kompleks: Ester asam lemak yang mengandung gugus lain di samping alkohol dan asam lemak Fosfolipid: Mengandung residu asam fosfat. Cth: liserofosfolipid, Sfingofosfolipid. Glikolipid (glikospingolipid); kelompok lipid yang mengandung asam lemak, sfigosin dan karbohidrat, Lipid komplek lain: Cth sulfolipid, aminolipid, lipoprotein 3. Prekursor dan devirat lipid: termasuk asam lemak, Gliserol, steroid, senyawa alkohol, aldehid lemak, badan keton, hidrokarbon, vitamin larut lemak, serta berbagai hormon.
Asam lemak Merupakan asam karboksilat yang mempunyai rantai karbon panjang dengan rumus umum: O R C OH Rantai karbon jenuh adalah rantai karbon yang tidak mengandung ikatan rangkap Rantai karbon tidak jenuh adalah rantai karbon yang tidak mengandung ikatan rangkap Tata Nama Asam Lemak Tak Jenuh CH3-(CH2)7-C=C-(CH2)7COOH Asan Sis-9-Oktadekenoat Asam Sis- 9 Oktadekenoat Asam Oleat (18:1:9) CH3-(CH2)5C=C-C=C-(CH2)7COOH Asam Sis-9-Sis-12 Oktadekadienoat Asam sis, sis 9,12 oktadekadienoat Asam Linoleat(18:2:9,12)
Sifat-sifat asam lemak Titik lebur tergantung dari: 1. Panjangnya rantai. Makin panjang rantainya makin tinggi Tlnya Mis: As.Laurat (12 Atom C) TL 480 C, As. Stearat (18 atom C) TL 690 C. 2. Derajat kejenuhan.makin banyak ikatan rangkap makin rendah titik leburnya 3. Rantai cabang.rantai karbon bercabang titik lebur dan titik didih lebih rendah daripada isomer yang rantai lurus 4. Daya larut. Pada umumnya rantai asam lemak makin panjang daya larut makin berkurang dan adanya gugusan hidroksil menambah daya larut.
Lemak : Suatu ester asam lemak dengan gliserol Gliserol: Suatu trihidroksi alkohol yang terdiri atas tiga atom karbon Sifat-sifat lemak 1. Tidak larut dalam air, tetapi larut dalam pelarut organik 2. Dapat dihidrolisa dengan : Asam: akan dilepas asam lemak bebas Alkali akan terjadi penyabunan Enzym (lipase pankreas) 3. Hidrogenasi dari lemak-lemak tidak jenuh dengan katalisator Ni disebut dengan pengerasan (pembuatan mentega) 4. Rancidity (ketengikan): perubahan kimia yang menimbulkan bau dan rasa yang tidak enak pada lemak dimana oksigen merusak ikatan rangkap dengan katalisator timah dan tembaga.
Thank You
Fatty Acid Oxidation
Fatty Acid Oxidation Activation and transfer of fatty acid Fatty acids must be activated in the cytoplasm before being oxidized in the mitochondria. Activation is catalyzed by fatty acyl-coa ligase (also called acyl- CoA synthetase or thiokinase). The net result of this activation process is the consumption of 2 molar equivalents of ATP. Fatty acid + ATP + CoA -------> Acyl-CoA + PPi + AMP Oxidation of fatty acids occurs in the mitochondria. The transport of fatty acyl- CoA into the mitochondria is accomplished via an acyl-carnitine intermediate
which itself is generated by the action of carnitine acyltransferase I, an enzyme that resides in the outer mitochondrial membrane, from acyl-coa and carnitine. The acyl-carnitine molecule then is transported into the mitochondria where carnitine acyltransferase II catalyzes the regeneration of the fatty acyl-coa molecule.
Reaction sequence in the β-oxidation The process of fatty acid oxidation is termed β- oxidation since it occurs through the sequential removal of 2- carbon units by oxidation at the β-carbon position of the fatty acyl-coa molecule.
Each round of β-oxidation produces one mole of NADH, one mole of FADH2 and one mole of acetyl-coa. The acetyl- CoA--- the end product of each round of β-oxidation--- then enters the TCA cycle, where it is further oxidized to CO2 with the concomitant generation of three moles of NADH, one mole of FADH2 and one mole of ATP. The NADH and FADH2 generated during the fat oxidation and acetyl-coa oxidation in the TCA cycle then can enter the respiratory pathway for the production of ATP. The oxidation of fatty acids yields significantly more energy per carbon atom than does the oxidation of carbohydrates. The net result of the oxidation of one mole of oleic acid (an 18- carbon fatty acid) will be 146 moles of ATP (2 mole equivalents are used during the activation of the fatty acid), as compared with 114 moles from an equivalent number of glucose carbon atoms.
Beta-Oxidation of Fatty Acids (even chain) Palmitoyl-CoA (16:0 trans-d2-palmitenoyl-coa (16:1tD2) Myristoyl-CoA (14:0) L-3-Hydoxypalmitoyl-CoA trans-d2-myristenoyl-coa (14:1tD2) 3-Ketopalmitoyl-CoA L-3-Hydoxymyristoyl-CoA
L-3-Hydoxylauroyl-CoA 3-Ketomyristoyl-CoA 3-Ketolauroyl-CoA Lauroyl-CoA (12:0) Caproyl-CoA (10:0) trans-d2-laurenoyl-coa (12:1tD2) trans-d2-caprenoyl-coa (10:1tD2)
trans-d2-caprylenoyl-coa (8:1tD2) L-3-Hydroxycaproyl-CoA L-3-Hydroxycapryloyl-CoA 3-Ketocaproyl-CoA 3-Ketocapryloyl-CoA Capryloyl-CoA (8:0) Hexanoyl-CoA (6:0)
Hexanoyl-CoA (6:0) Butanoyl-CoA (4:0) trans-d2-hexenoyl-coa (6:1tD2) trans-d2-butenoyl-coa (4:1tD2) L-3-Hydroxyhexanoyl-CoA 3-Hydroxybutanoyl-CoA 3-Ketohexanoyl-CoA
3-Ketobutanoyl-CoA Acetyl-CoA + Acetyl-CoA
Thank You